C25H38N2 — CID 143755945
(Z)-2-[8-(2-cyclohexylethyl)-3a,6-dihydrocyclohepta[b]pyrrol-3-yl]-N-ethylbut-2-en-1-imine;ethane (PubChem CID 143755945) has the molecular formula C25H38N2 and a molecular weight of 366.59 g/mol. Its IUPAC name is (Z)-2-[8-(2-cyclohexylethyl)-3a,6-dihydrocyclohepta[b]pyrrol-3-yl]-N-ethylbut-2-en-1-imine;ethane.
| Compound Name | (Z)-2-[8-(2-cyclohexylethyl)-3a,6-dihydrocyclohepta[b]pyrrol-3-yl]-N-ethylbut-2-en-1-imine;ethane |
|---|---|
| PubChem CID | 143755945 |
| Molecular Formula | C25H38N2 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | (Z)-2-[8-(2-cyclohexylethyl)-3a,6-dihydrocyclohepta[b]pyrrol-3-yl]-N-ethylbut-2-en-1-imine;ethane |
| SMILES | C/C=C(\C=N\CC)C1=CN=C2C(CCC3CCCCC3)=CCC=CC12.CC |
| InChI | InChI=1S/C23H32N2.C2H6/c1-3-19(16-24-4-2)22-17-25-23-20(12-8-9-13-21(22)23)15-14-18-10-6-5-7-11-18;1-2/h3,9,12-13,16-18,21H,4-8,10-11,14-15H2,1-2H3;1-2H3/b19-3+,24-16+; |
| InChIKey | VGDMOCBUPQYPCX-HXLGATMYSA-N |
| XLogP | 7.25 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|