C24H22F2N2O2S — CID 143757478
[(E)-2-methylbut-1-enyl] 4-[4-[(2,6-difluorobenzoyl)amino]phenyl]-5-methylthiophene-2-carboximidate (PubChem CID 143757478) has the molecular formula C24H22F2N2O2S and a molecular weight of 440.52 g/mol. Its IUPAC name is [(E)-2-methylbut-1-enyl] 4-[4-[(2,6-difluorobenzoyl)amino]phenyl]-5-methylthiophene-2-carboximidate.
| Compound Name | [(E)-2-methylbut-1-enyl] 4-[4-[(2,6-difluorobenzoyl)amino]phenyl]-5-methylthiophene-2-carboximidate |
|---|---|
| PubChem CID | 143757478 |
| Molecular Formula | C24H22F2N2O2S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | [(E)-2-methylbut-1-enyl] 4-[4-[(2,6-difluorobenzoyl)amino]phenyl]-5-methylthiophene-2-carboximidate |
| SMILES | [H]/N=C(\O/C=C(\C)CC)c1cc(-c2ccc(NC(=O)c3c(F)cccc3F)cc2)c(C)s1 |
| InChI | InChI=1S/C24H22F2N2O2S/c1-4-14(2)13-30-23(27)21-12-18(15(3)31-21)16-8-10-17(11-9-16)28-24(29)22-19(25)6-5-7-20(22)26/h5-13,27H,4H2,1-3H3,(H,28,29)/b14-13+,27-23- |
| InChIKey | RMEDSFJIDWUUPC-RVPACIEWSA-N |
| XLogP | 6.91 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|