C14H11N — CID 143757983
2-azatetracyclo[8.5.0.03,8.012,14]pentadeca-1(15),2,4,6,8,10-hexaene (PubChem CID 143757983) has the molecular formula C14H11N and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-azatetracyclo[8.5.0.03,8.012,14]pentadeca-1(15),2,4,6,8,10-hexaene.
| Compound Name | 2-azatetracyclo[8.5.0.03,8.012,14]pentadeca-1(15),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 143757983 |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-azatetracyclo[8.5.0.03,8.012,14]pentadeca-1(15),2,4,6,8,10-hexaene |
| SMILES | C1=c2cc3ccccc3nc2=CC2CC12 |
| InChI | InChI=1S/C14H11N/c1-2-4-13-9(3-1)5-12-7-10-6-11(10)8-14(12)15-13/h1-5,7-8,10-11H,6H2 |
| InChIKey | PNQZKIDKXKJBJT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |