C20H22Br2N4O3S — CID 143767543
2,5-dibromo-N-[(3R,5R)-1-cyano-5-[[[hydroxy-(3-methylphenyl)methyl]amino]methyl]pyrrolidin-3-yl]benzenesulfonamide (PubChem CID 143767543) has the molecular formula C20H22Br2N4O3S and a molecular weight of 558.30 g/mol. Its IUPAC name is 2,5-dibromo-N-[(3R,5R)-1-cyano-5-[[[hydroxy-(3-methylphenyl)methyl]amino]methyl]pyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | 2,5-dibromo-N-[(3R,5R)-1-cyano-5-[[[hydroxy-(3-methylphenyl)methyl]amino]methyl]pyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 143767543 |
| Molecular Formula | C20H22Br2N4O3S |
| Molecular Weight | 558.30 g/mol |
| Exact Mass | 555.98 |
| IUPAC Name | 2,5-dibromo-N-[(3R,5R)-1-cyano-5-[[[hydroxy-(3-methylphenyl)methyl]amino]methyl]pyrrolidin-3-yl]benzenesulfonamide |
| SMILES | Cc1cccc(C(O)NC[C@H]2C[C@@H](NS(=O)(=O)c3cc(Br)ccc3Br)CN2C#N)c1 |
| InChI | InChI=1S/C20H22Br2N4O3S/c1-13-3-2-4-14(7-13)20(27)24-10-17-9-16(11-26(17)12-23)25-30(28,29)19-8-15(21)5-6-18(19)22/h2-8,16-17,20,24-25,27H,9-11H2,1H3/t16-,17-,20?/m1/s1 |
| InChIKey | ZMQGTQQKYFWAGL-LGJCEAAXSA-N |
| XLogP | 3.00 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|