C16H20Br2N4O2S — CID 25196577
2,5-dibromo-N-[(3R,5R)-1-cyano-5-(pyrrolidin-1-ylmethyl)pyrrolidin-3-yl]benzenesulfonamide (PubChem CID 25196577) has the molecular formula C16H20Br2N4O2S and a molecular weight of 492.24 g/mol. Its IUPAC name is 2,5-dibromo-N-[(3R,5R)-1-cyano-5-(pyrrolidin-1-ylmethyl)pyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | 2,5-dibromo-N-[(3R,5R)-1-cyano-5-(pyrrolidin-1-ylmethyl)pyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25196577 |
| Molecular Formula | C16H20Br2N4O2S |
| Molecular Weight | 492.24 g/mol |
| Exact Mass | 489.97 |
| IUPAC Name | 2,5-dibromo-N-[(3R,5R)-1-cyano-5-(pyrrolidin-1-ylmethyl)pyrrolidin-3-yl]benzenesulfonamide |
| SMILES | N#CN1C[C@H](NS(=O)(=O)c2cc(Br)ccc2Br)C[C@@H]1CN1CCCC1 |
| InChI | InChI=1S/C16H20Br2N4O2S/c17-12-3-4-15(18)16(7-12)25(23,24)20-13-8-14(22(9-13)11-19)10-21-5-1-2-6-21/h3-4,7,13-14,20H,1-2,5-6,8-10H2/t13-,14-/m1/s1 |
| InChIKey | PZXPYKUUCVPYFX-ZIAGYGMSSA-N |
| XLogP | 2.51 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|