C14H17Br2N3O2S — CID 89142687
2,5-dibromo-N-[(5R)-1-cyano-5-propan-2-ylpyrrolidin-3-yl]benzenesulfonamide (PubChem CID 89142687) has the molecular formula C14H17Br2N3O2S and a molecular weight of 451.18 g/mol. Its IUPAC name is 2,5-dibromo-N-[(5R)-1-cyano-5-propan-2-ylpyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | 2,5-dibromo-N-[(5R)-1-cyano-5-propan-2-ylpyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 89142687 |
| Molecular Formula | C14H17Br2N3O2S |
| Molecular Weight | 451.18 g/mol |
| Exact Mass | 448.94 |
| IUPAC Name | 2,5-dibromo-N-[(5R)-1-cyano-5-propan-2-ylpyrrolidin-3-yl]benzenesulfonamide |
| SMILES | CC(C)[C@H]1CC(NS(=O)(=O)c2cc(Br)ccc2Br)CN1C#N |
| InChI | InChI=1S/C14H17Br2N3O2S/c1-9(2)13-6-11(7-19(13)8-17)18-22(20,21)14-5-10(15)3-4-12(14)16/h3-5,9,11,13,18H,6-7H2,1-2H3/t11?,13-/m1/s1 |
| InChIKey | MCYVFOZFBRUCPQ-GLGOKHISSA-N |
| XLogP | 3.07 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.18 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|