C12H12BrF2N3O2S — CID 76641278
5-bromo-N-(1-cyano-5-methylpyrrolidin-3-yl)-2,4-difluorobenzenesulfonamide (PubChem CID 76641278) has the molecular formula C12H12BrF2N3O2S and a molecular weight of 380.21 g/mol. Its IUPAC name is 5-bromo-N-(1-cyano-5-methylpyrrolidin-3-yl)-2,4-difluorobenzenesulfonamide.
| Compound Name | 5-bromo-N-(1-cyano-5-methylpyrrolidin-3-yl)-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 76641278 |
| Molecular Formula | C12H12BrF2N3O2S |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 378.98 |
| IUPAC Name | 5-bromo-N-(1-cyano-5-methylpyrrolidin-3-yl)-2,4-difluorobenzenesulfonamide |
| SMILES | CC1CC(NS(=O)(=O)c2cc(Br)c(F)cc2F)CN1C#N |
| InChI | InChI=1S/C12H12BrF2N3O2S/c1-7-2-8(5-18(7)6-16)17-21(19,20)12-3-9(13)10(14)4-11(12)15/h3-4,7-8,17H,2,5H2,1H3 |
| InChIKey | FVONEDBDODULDZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|