C30H40FN5O — CID 143779958
5-fluoro-N',2-dimethyl-6-[(1E)-1-(6-methyl-1H-pyridin-2-ylidene)prop-2-enyl]pyridine-3-carboximidamide;4-(methylamino)benzaldehyde;2-methylbutane (PubChem CID 143779958) has the molecular formula C30H40FN5O and a molecular weight of 505.68 g/mol. Its IUPAC name is 5-fluoro-N',2-dimethyl-6-[(1E)-1-(6-methyl-1H-pyridin-2-ylidene)prop-2-enyl]pyridine-3-carboximidamide;4-(methylamino)benzaldehyde;2-methylbutane.
| Compound Name | 5-fluoro-N',2-dimethyl-6-[(1E)-1-(6-methyl-1H-pyridin-2-ylidene)prop-2-enyl]pyridine-3-carboximidamide;4-(methylamino)benzaldehyde;2-methylbutane |
|---|---|
| PubChem CID | 143779958 |
| Molecular Formula | C30H40FN5O |
| Molecular Weight | 505.68 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | 5-fluoro-N',2-dimethyl-6-[(1E)-1-(6-methyl-1H-pyridin-2-ylidene)prop-2-enyl]pyridine-3-carboximidamide;4-(methylamino)benzaldehyde;2-methylbutane |
| SMILES | C=C/C(=C1/C=CC=C(C)N1)c1nc(C)c(/C(N)=N/C)cc1F.CCC(C)C.CNc1ccc(C=O)cc1 |
| InChI | InChI=1S/C17H19FN4.C8H9NO.C5H12/c1-5-12(15-8-6-7-10(2)21-15)16-14(18)9-13(11(3)22-16)17(19)20-4;1-9-8-4-2-7(6-10)3-5-8;1-4-5(2)3/h5-9,21H,1H2,2-4H3,(H2,19,20);2-6,9H,1H3;5H,4H2,1-3H3/b15-12+;; |
| InChIKey | ADVNAEGUHLTRHA-BXHFOUFMSA-N |
| XLogP | 6.42 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.68 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|