C26H36F3N3 — CID 143795118
(Z,3S)-4-N-[(E)-1-(2,5-difluorophenyl)ethylideneamino]-3-ethenyl-4-N-(3-fluorobut-1-en-2-yl)-4-methyl-5-propan-2-ylideneoct-6-ene-1,4-diamine (PubChem CID 143795118) has the molecular formula C26H36F3N3 and a molecular weight of 447.59 g/mol. Its IUPAC name is (Z,3S)-4-N-[(E)-1-(2,5-difluorophenyl)ethylideneamino]-3-ethenyl-4-N-(3-fluorobut-1-en-2-yl)-4-methyl-5-propan-2-ylideneoct-6-ene-1,4-diamine.
| Compound Name | (Z,3S)-4-N-[(E)-1-(2,5-difluorophenyl)ethylideneamino]-3-ethenyl-4-N-(3-fluorobut-1-en-2-yl)-4-methyl-5-propan-2-ylideneoct-6-ene-1,4-diamine |
|---|---|
| PubChem CID | 143795118 |
| Molecular Formula | C26H36F3N3 |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | (Z,3S)-4-N-[(E)-1-(2,5-difluorophenyl)ethylideneamino]-3-ethenyl-4-N-(3-fluorobut-1-en-2-yl)-4-methyl-5-propan-2-ylideneoct-6-ene-1,4-diamine |
| SMILES | C=C[C@H](CCN)C(C)(C(/C=C\C)=C(C)C)N(/N=C(\C)c1cc(F)ccc1F)C(=C)C(C)F |
| InChI | InChI=1S/C26H36F3N3/c1-9-11-24(17(3)4)26(8,21(10-2)14-15-30)32(20(7)18(5)27)31-19(6)23-16-22(28)12-13-25(23)29/h9-13,16,18,21H,2,7,14-15,30H2,1,3-6,8H3/b11-9-,31-19+/t18?,21-,26?/m1/s1 |
| InChIKey | NSWSBNLLXOQUGR-DCFMLSCGSA-N |
| XLogP | 6.68 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|