C22H28O4 — CID 143797209
3-[4-[(E)-2,4-dimethyl-6-oxooct-2-enoxy]phenyl]hex-4-ynoic acid (PubChem CID 143797209) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is 3-[4-[(E)-2,4-dimethyl-6-oxooct-2-enoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[(E)-2,4-dimethyl-6-oxooct-2-enoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 143797209 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 3-[4-[(E)-2,4-dimethyl-6-oxooct-2-enoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OC/C(C)=C/C(C)CC(=O)CC)cc1 |
| InChI | InChI=1S/C22H28O4/c1-5-7-19(14-22(24)25)18-8-10-21(11-9-18)26-15-17(4)12-16(3)13-20(23)6-2/h8-12,16,19H,6,13-15H2,1-4H3,(H,24,25)/b17-12+ |
| InChIKey | WLVSQEAFAQCNDO-SFQUDFHCSA-N |
| XLogP | 4.60 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|