C17H23NO5 — CID 143821450
4-(4-methoxybutyl)-2-(methoxymethyl)-2-methyl-3-oxo-1,4-benzoxazine-6-carbaldehyde (PubChem CID 143821450) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is 4-(4-methoxybutyl)-2-(methoxymethyl)-2-methyl-3-oxo-1,4-benzoxazine-6-carbaldehyde.
| Compound Name | 4-(4-methoxybutyl)-2-(methoxymethyl)-2-methyl-3-oxo-1,4-benzoxazine-6-carbaldehyde |
|---|---|
| PubChem CID | 143821450 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 4-(4-methoxybutyl)-2-(methoxymethyl)-2-methyl-3-oxo-1,4-benzoxazine-6-carbaldehyde |
| SMILES | COCCCCN1C(=O)C(C)(COC)Oc2ccc(C=O)cc21 |
| InChI | InChI=1S/C17H23NO5/c1-17(12-22-3)16(20)18(8-4-5-9-21-2)14-10-13(11-19)6-7-15(14)23-17/h6-7,10-11H,4-5,8-9,12H2,1-3H3 |
| InChIKey | DUYNCYROUYGQQN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|