C21H28F3N5O2 — CID 143879242
(2S)-4-methyl-N-[2-(pyridin-2-ylamino)ethyl]-2-[[(1S)-2,2,2-trifluoro-1-(6-methoxy-3-pyridinyl)ethyl]amino]pentanamide (PubChem CID 143879242) has the molecular formula C21H28F3N5O2 and a molecular weight of 439.48 g/mol. Its IUPAC name is (2S)-4-methyl-N-[2-(pyridin-2-ylamino)ethyl]-2-[[(1S)-2,2,2-trifluoro-1-(6-methoxy-3-pyridinyl)ethyl]amino]pentanamide.
| Compound Name | (2S)-4-methyl-N-[2-(pyridin-2-ylamino)ethyl]-2-[[(1S)-2,2,2-trifluoro-1-(6-methoxy-3-pyridinyl)ethyl]amino]pentanamide |
|---|---|
| PubChem CID | 143879242 |
| Molecular Formula | C21H28F3N5O2 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | (2S)-4-methyl-N-[2-(pyridin-2-ylamino)ethyl]-2-[[(1S)-2,2,2-trifluoro-1-(6-methoxy-3-pyridinyl)ethyl]amino]pentanamide |
| SMILES | COc1ccc([C@H](N[C@@H](CC(C)C)C(=O)NCCNc2ccccn2)C(F)(F)F)cn1 |
| InChI | InChI=1S/C21H28F3N5O2/c1-14(2)12-16(20(30)27-11-10-26-17-6-4-5-9-25-17)29-19(21(22,23)24)15-7-8-18(31-3)28-13-15/h4-9,13-14,16,19,29H,10-12H2,1-3H3,(H,25,26)(H,27,30)/t16-,19-/m0/s1 |
| InChIKey | JESQTYULHOSRSO-LPHOPBHVSA-N |
| XLogP | 3.32 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|