C12H21F2N3O — CID 143883720
ethene;4-ethyl-5-fluoro-6-methoxy-N,N-dimethylpyrimidin-2-amine;fluoromethane (PubChem CID 143883720) has the molecular formula C12H21F2N3O and a molecular weight of 261.32 g/mol. Its IUPAC name is ethene;4-ethyl-5-fluoro-6-methoxy-N,N-dimethylpyrimidin-2-amine;fluoromethane.
| Compound Name | ethene;4-ethyl-5-fluoro-6-methoxy-N,N-dimethylpyrimidin-2-amine;fluoromethane |
|---|---|
| PubChem CID | 143883720 |
| Molecular Formula | C12H21F2N3O |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | ethene;4-ethyl-5-fluoro-6-methoxy-N,N-dimethylpyrimidin-2-amine;fluoromethane |
| SMILES | C=C.CCc1nc(N(C)C)nc(OC)c1F.CF |
| InChI | InChI=1S/C9H14FN3O.C2H4.CH3F/c1-5-6-7(10)8(14-4)12-9(11-6)13(2)3;2*1-2/h5H2,1-4H3;1-2H2;1H3 |
| InChIKey | HMSIXVASNXACJV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|