C35H33N5O4 — CID 143887477
1-[4-[2-[[5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]ethyl]phenyl]-3-[(3E)-hexa-1,3,5-trien-3-yl]urea (PubChem CID 143887477) has the molecular formula C35H33N5O4 and a molecular weight of 587.68 g/mol. Its IUPAC name is 1-[4-[2-[[5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]ethyl]phenyl]-3-[(3E)-hexa-1,3,5-trien-3-yl]urea.
| Compound Name | 1-[4-[2-[[5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]ethyl]phenyl]-3-[(3E)-hexa-1,3,5-trien-3-yl]urea |
|---|---|
| PubChem CID | 143887477 |
| Molecular Formula | C35H33N5O4 |
| Molecular Weight | 587.68 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | 1-[4-[2-[[5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]ethyl]phenyl]-3-[(3E)-hexa-1,3,5-trien-3-yl]urea |
| SMILES | C=C/C=C(\C=C)NC(=O)Nc1ccc(CCNc2ncnc3oc(-c4ccc(OC)cc4)c(-c4ccc(OC)cc4)c23)cc1 |
| InChI | InChI=1S/C35H33N5O4/c1-5-7-26(6-2)39-35(41)40-27-14-8-23(9-15-27)20-21-36-33-31-30(24-10-16-28(42-3)17-11-24)32(44-34(31)38-22-37-33)25-12-18-29(43-4)19-13-25/h5-19,22H,1-2,20-21H2,3-4H3,(H,36,37,38)(H2,39,40,41)/b26-7+ |
| InChIKey | FMMHEXDFWFHWBV-IOXBOXJCSA-N |
| XLogP | 7.61 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.68 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|