C23H37NO2 — CID 143899703
(10aS)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydro-4H-isochromeno[3,4-b]pyridin-1-one (PubChem CID 143899703) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is (10aS)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydro-4H-isochromeno[3,4-b]pyridin-1-one.
| Compound Name | (10aS)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydro-4H-isochromeno[3,4-b]pyridin-1-one |
|---|---|
| PubChem CID | 143899703 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | (10aS)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydro-4H-isochromeno[3,4-b]pyridin-1-one |
| SMILES | CCCCCCC(C)(C)c1cc(=O)c2c([nH]1)OC(C)(C)C1CCCC[C@H]21 |
| InChI | InChI=1S/C23H37NO2/c1-6-7-8-11-14-22(2,3)19-15-18(25)20-16-12-9-10-13-17(16)23(4,5)26-21(20)24-19/h15-17H,6-14H2,1-5H3,(H,24,25)/t16-,17?/m0/s1 |
| InChIKey | JWKABNLBZLZAJV-BHWOMJMDSA-N |
| XLogP | 6.07 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|