C51H34O6S — CID 143912487
8-(benzenecarbonothioyl)-4-methyl-9-phenylfuro[2,3-h]chromen-2-one;4-methyl-9-phenyl-8-(1-phenylethenyl)furo[2,3-h]chromen-2-one (PubChem CID 143912487) has the molecular formula C51H34O6S and a molecular weight of 774.89 g/mol. Its IUPAC name is 8-(benzenecarbonothioyl)-4-methyl-9-phenylfuro[2,3-h]chromen-2-one;4-methyl-9-phenyl-8-(1-phenylethenyl)furo[2,3-h]chromen-2-one.
| Compound Name | 8-(benzenecarbonothioyl)-4-methyl-9-phenylfuro[2,3-h]chromen-2-one;4-methyl-9-phenyl-8-(1-phenylethenyl)furo[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 143912487 |
| Molecular Formula | C51H34O6S |
| Molecular Weight | 774.89 g/mol |
| Exact Mass | 774.21 |
| IUPAC Name | 8-(benzenecarbonothioyl)-4-methyl-9-phenylfuro[2,3-h]chromen-2-one;4-methyl-9-phenyl-8-(1-phenylethenyl)furo[2,3-h]chromen-2-one |
| SMILES | C=C(c1ccccc1)c1oc2ccc3c(C)cc(=O)oc3c2c1-c1ccccc1.Cc1cc(=O)oc2c1ccc1oc(C(=S)c3ccccc3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C26H18O3.C25H16O3S/c1-16-15-22(27)29-26-20(16)13-14-21-24(26)23(19-11-7-4-8-12-19)25(28-21)17(2)18-9-5-3-6-10-18;1-15-14-20(26)28-23-18(15)12-13-19-22(23)21(16-8-4-2-5-9-16)24(27-19)25(29)17-10-6-3-7-11-17/h3-15H,2H2,1H3;2-14H,1H3 |
| InChIKey | AFDUXHRPPICEBR-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 86.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.89 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|