C20H24FN3OS — CID 143922162
5-(cyclopropylsulfanylamino)-6-(2-fluoro-4-methylanilino)-2,3-dihydroisoindol-1-one;ethane (PubChem CID 143922162) has the molecular formula C20H24FN3OS and a molecular weight of 373.50 g/mol. Its IUPAC name is 5-(cyclopropylsulfanylamino)-6-(2-fluoro-4-methylanilino)-2,3-dihydroisoindol-1-one;ethane.
| Compound Name | 5-(cyclopropylsulfanylamino)-6-(2-fluoro-4-methylanilino)-2,3-dihydroisoindol-1-one;ethane |
|---|---|
| PubChem CID | 143922162 |
| Molecular Formula | C20H24FN3OS |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 5-(cyclopropylsulfanylamino)-6-(2-fluoro-4-methylanilino)-2,3-dihydroisoindol-1-one;ethane |
| SMILES | CC.Cc1ccc(Nc2cc3c(cc2NSC2CC2)CNC3=O)c(F)c1 |
| InChI | InChI=1S/C18H18FN3OS.C2H6/c1-10-2-5-15(14(19)6-10)21-16-8-13-11(9-20-18(13)23)7-17(16)22-24-12-3-4-12;1-2/h2,5-8,12,21-22H,3-4,9H2,1H3,(H,20,23);1-2H3 |
| InChIKey | CBQABDOMUAMCPE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|