C20H26ClN5O3 — CID 143946900
1-[[2-amino-6-chloro-5-[2-(6-ethoxy-2-methyl-3-pyridinyl)ethynyl]pyrimidin-4-yl]amino]-3-ethylbutane-1,4-diol (PubChem CID 143946900) has the molecular formula C20H26ClN5O3 and a molecular weight of 419.91 g/mol. Its IUPAC name is 1-[[2-amino-6-chloro-5-[2-(6-ethoxy-2-methyl-3-pyridinyl)ethynyl]pyrimidin-4-yl]amino]-3-ethylbutane-1,4-diol.
| Compound Name | 1-[[2-amino-6-chloro-5-[2-(6-ethoxy-2-methyl-3-pyridinyl)ethynyl]pyrimidin-4-yl]amino]-3-ethylbutane-1,4-diol |
|---|---|
| PubChem CID | 143946900 |
| Molecular Formula | C20H26ClN5O3 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 1-[[2-amino-6-chloro-5-[2-(6-ethoxy-2-methyl-3-pyridinyl)ethynyl]pyrimidin-4-yl]amino]-3-ethylbutane-1,4-diol |
| SMILES | CCOc1ccc(C#Cc2c(Cl)nc(N)nc2NC(O)CC(CC)CO)c(C)n1 |
| InChI | InChI=1S/C20H26ClN5O3/c1-4-13(11-27)10-16(28)24-19-15(18(21)25-20(22)26-19)8-6-14-7-9-17(29-5-2)23-12(14)3/h7,9,13,16,27-28H,4-5,10-11H2,1-3H3,(H3,22,24,25,26) |
| InChIKey | ZGTZYIKXBBYVEA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|