C23H19NO4S — CID 143954291
4-(5-methyl-1-benzofuran-2-yl)-2-(3-phenylpropanoylamino)thiophene-3-carboxylic acid (PubChem CID 143954291) has the molecular formula C23H19NO4S and a molecular weight of 405.48 g/mol. Its IUPAC name is 4-(5-methyl-1-benzofuran-2-yl)-2-(3-phenylpropanoylamino)thiophene-3-carboxylic acid.
| Compound Name | 4-(5-methyl-1-benzofuran-2-yl)-2-(3-phenylpropanoylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 143954291 |
| Molecular Formula | C23H19NO4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 4-(5-methyl-1-benzofuran-2-yl)-2-(3-phenylpropanoylamino)thiophene-3-carboxylic acid |
| SMILES | Cc1ccc2oc(-c3csc(NC(=O)CCc4ccccc4)c3C(=O)O)cc2c1 |
| InChI | InChI=1S/C23H19NO4S/c1-14-7-9-18-16(11-14)12-19(28-18)17-13-29-22(21(17)23(26)27)24-20(25)10-8-15-5-3-2-4-6-15/h2-7,9,11-13H,8,10H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | XDYAQKILXWDLAO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |