About (Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine
(Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine (PubChem CID 143962809) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is (Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine.
Molecular Properties
| Compound Name | (Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine |
| PubChem CID | 143962809 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine |
| SMILES | [H]/N=C(C(\C)=C(\C)N)/C(C)(C)C |
| InChI | InChI=1S/C9H18N2/c1-6(7(2)10)8(11)9(3,4)5/h11H,10H2,1-5H3/b7-6-,11-8+ |
| InChIKey | CNGOSVNINOFYJY-BQGCWICQSA-N |
| XLogP | 2.30 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine?
The IUPAC name of (Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine (CID 143962809) is (Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine.
What is the SMILES notation for (Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine?
The canonical SMILES for (Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine is [H]/N=C(C(\C)=C(\C)N)/C(C)(C)C.
What is the InChIKey of (Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine?
The InChIKey is CNGOSVNINOFYJY-BQGCWICQSA-N. The full InChI is InChI=1S/C9H18N2/c1-6(7(2)10)8(11)9(3,4)5/h11H,10H2,1-5H3/b7-6-,11-8+.
What are the key properties of (Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine?
(Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine has a molecular weight of 154.26 g/mol, XLogP of 2.30, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-imino-3,5,5-trimethylhex-2-en-2-amine is sourced from PubChem (CID 143962809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).