C28H36N8O2 — CID 143964064
2-amino-9-[(2E,4E,6E,8E)-3,7-dimethyl-9-(4,4,6-trimethyl-2,3-dihydro-1H-pyridin-5-yl)nona-2,4,6,8-tetraenoyl]-1-methylpurin-6-one;1H-imidazole (PubChem CID 143964064) has the molecular formula C28H36N8O2 and a molecular weight of 516.65 g/mol. Its IUPAC name is 2-amino-9-[(2E,4E,6E,8E)-3,7-dimethyl-9-(4,4,6-trimethyl-2,3-dihydro-1H-pyridin-5-yl)nona-2,4,6,8-tetraenoyl]-1-methylpurin-6-one;1H-imidazole.
| Compound Name | 2-amino-9-[(2E,4E,6E,8E)-3,7-dimethyl-9-(4,4,6-trimethyl-2,3-dihydro-1H-pyridin-5-yl)nona-2,4,6,8-tetraenoyl]-1-methylpurin-6-one;1H-imidazole |
|---|---|
| PubChem CID | 143964064 |
| Molecular Formula | C28H36N8O2 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 2-amino-9-[(2E,4E,6E,8E)-3,7-dimethyl-9-(4,4,6-trimethyl-2,3-dihydro-1H-pyridin-5-yl)nona-2,4,6,8-tetraenoyl]-1-methylpurin-6-one;1H-imidazole |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)n2cnc3c(=O)n(C)c(N)nc32)C(C)(C)CCN1.c1c[nH]cn1 |
| InChI | InChI=1S/C25H32N6O2.C3H4N2/c1-16(10-11-19-18(3)27-13-12-25(19,4)5)8-7-9-17(2)14-20(32)31-15-28-21-22(31)29-24(26)30(6)23(21)33;1-2-5-3-4-1/h7-11,14-15,27H,12-13H2,1-6H3,(H2,26,29);1-3H,(H,4,5)/b9-7+,11-10+,16-8+,17-14+; |
| InChIKey | YNIVCCSCFCFWIL-DUJOATIMSA-N |
| XLogP | 4.06 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|