C9H15NO2 — CID 143972945
(2R)-1-amino-3-[(3E)-hexa-1,3,5-trien-3-yl]oxypropan-2-ol (PubChem CID 143972945) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (2R)-1-amino-3-[(3E)-hexa-1,3,5-trien-3-yl]oxypropan-2-ol.
| Compound Name | (2R)-1-amino-3-[(3E)-hexa-1,3,5-trien-3-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 143972945 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (2R)-1-amino-3-[(3E)-hexa-1,3,5-trien-3-yl]oxypropan-2-ol |
| SMILES | C=C/C=C(\C=C)OC[C@H](O)CN |
| InChI | InChI=1S/C9H15NO2/c1-3-5-9(4-2)12-7-8(11)6-10/h3-5,8,11H,1-2,6-7,10H2/b9-5+/t8-/m1/s1 |
| InChIKey | KJFXEUGODLJYLL-CBVZUMJXSA-N |
| XLogP | 0.58 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|