C20H22N6O3 — CID 143991775
4-[(2-methyl-4-oxo-3H-pteridin-6-yl)methylamino]-N-(4-oxopentyl)benzamide (PubChem CID 143991775) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is 4-[(2-methyl-4-oxo-3H-pteridin-6-yl)methylamino]-N-(4-oxopentyl)benzamide.
| Compound Name | 4-[(2-methyl-4-oxo-3H-pteridin-6-yl)methylamino]-N-(4-oxopentyl)benzamide |
|---|---|
| PubChem CID | 143991775 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 4-[(2-methyl-4-oxo-3H-pteridin-6-yl)methylamino]-N-(4-oxopentyl)benzamide |
| SMILES | CC(=O)CCCNC(=O)c1ccc(NCc2cnc3nc(C)[nH]c(=O)c3n2)cc1 |
| InChI | InChI=1S/C20H22N6O3/c1-12(27)4-3-9-21-19(28)14-5-7-15(8-6-14)22-10-16-11-23-18-17(26-16)20(29)25-13(2)24-18/h5-8,11,22H,3-4,9-10H2,1-2H3,(H,21,28)(H,23,24,25,29) |
| InChIKey | IPUOQVTUCPHJHO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|