C28H38N10O5 — CID 166558082
N-[4-(3-amino-3,9-diazaspiro[5.5]undecan-9-yl)-4-oxobutyl]-4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzamide;formic acid (PubChem CID 166558082) has the molecular formula C28H38N10O5 and a molecular weight of 594.68 g/mol. Its IUPAC name is N-[4-(3-amino-3,9-diazaspiro[5.5]undecan-9-yl)-4-oxobutyl]-4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzamide;formic acid.
| Compound Name | N-[4-(3-amino-3,9-diazaspiro[5.5]undecan-9-yl)-4-oxobutyl]-4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzamide;formic acid |
|---|---|
| PubChem CID | 166558082 |
| Molecular Formula | C28H38N10O5 |
| Molecular Weight | 594.68 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | N-[4-(3-amino-3,9-diazaspiro[5.5]undecan-9-yl)-4-oxobutyl]-4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzamide;formic acid |
| SMILES | Nc1nc2ncc(CNc3ccc(C(=O)NCCCC(=O)N4CCC5(CCN(N)CC5)CC4)cc3)nc2c(=O)[nH]1.O=CO |
| InChI | InChI=1S/C27H36N10O3.CH2O2/c28-26-34-23-22(25(40)35-26)33-20(17-32-23)16-31-19-5-3-18(4-6-19)24(39)30-11-1-2-21(38)36-12-7-27(8-13-36)9-14-37(29)15-10-27;2-1-3/h3-6,17,31H,1-2,7-16,29H2,(H,30,39)(H3,28,32,34,35,40);1H,(H,2,3) |
| InChIKey | XTVLPVYSSPPTQR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 225.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.68 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|