C24H38OS — CID 144503355
buta-1,3-diene;3-[(2Z,4E,6Z)-4-ethenylocta-2,4,6-trien-2-yl]-1,2,2-trimethylcyclopentane-1-carbaldehyde;methanethiol (PubChem CID 144503355) has the molecular formula C24H38OS and a molecular weight of 374.63 g/mol. Its IUPAC name is buta-1,3-diene;3-[(2Z,4E,6Z)-4-ethenylocta-2,4,6-trien-2-yl]-1,2,2-trimethylcyclopentane-1-carbaldehyde;methanethiol.
| Compound Name | buta-1,3-diene;3-[(2Z,4E,6Z)-4-ethenylocta-2,4,6-trien-2-yl]-1,2,2-trimethylcyclopentane-1-carbaldehyde;methanethiol |
|---|---|
| PubChem CID | 144503355 |
| Molecular Formula | C24H38OS |
| Molecular Weight | 374.63 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | buta-1,3-diene;3-[(2Z,4E,6Z)-4-ethenylocta-2,4,6-trien-2-yl]-1,2,2-trimethylcyclopentane-1-carbaldehyde;methanethiol |
| SMILES | C=CC(/C=C(/C)C1CCC(C)(C=O)C1(C)C)=C\C=C/C.C=CC=C.CS |
| InChI | InChI=1S/C19H28O.C4H6.CH4S/c1-7-9-10-16(8-2)13-15(3)17-11-12-19(6,14-20)18(17,4)5;1-3-4-2;1-2/h7-10,13-14,17H,2,11-12H2,1,3-6H3;3-4H,1-2H2;2H,1H3/b9-7-,15-13-,16-10+;; |
| InChIKey | JPBKOMBZVAQQOU-ZZKRPZILSA-N |
| XLogP | 7.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.63 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|