C15H24F2O4S — CID 144518092
(3-ethyl-7-methyl-4-oxo-1-bicyclo[3.3.1]nonanyl) 2,2-difluoro-2-sulfanylacetate;methanol (PubChem CID 144518092) has the molecular formula C15H24F2O4S and a molecular weight of 338.42 g/mol. Its IUPAC name is (3-ethyl-7-methyl-4-oxo-1-bicyclo[3.3.1]nonanyl) 2,2-difluoro-2-sulfanylacetate;methanol.
| Compound Name | (3-ethyl-7-methyl-4-oxo-1-bicyclo[3.3.1]nonanyl) 2,2-difluoro-2-sulfanylacetate;methanol |
|---|---|
| PubChem CID | 144518092 |
| Molecular Formula | C15H24F2O4S |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (3-ethyl-7-methyl-4-oxo-1-bicyclo[3.3.1]nonanyl) 2,2-difluoro-2-sulfanylacetate;methanol |
| SMILES | CCC1CC2(OC(=O)C(F)(F)S)CC(C)CC(C2)C1=O.CO |
| InChI | InChI=1S/C14H20F2O3S.CH4O/c1-3-9-6-13(19-12(18)14(15,16)20)5-8(2)4-10(7-13)11(9)17;1-2/h8-10,20H,3-7H2,1-2H3;2H,1H3 |
| InChIKey | UZRFWBULQOJPHZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|