C13H20F2O6S — CID 163460881
2-(3,5-diethyl-1-methyl-2-oxocyclohexyl)oxy-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 163460881) has the molecular formula C13H20F2O6S and a molecular weight of 342.36 g/mol. Its IUPAC name is 2-(3,5-diethyl-1-methyl-2-oxocyclohexyl)oxy-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-(3,5-diethyl-1-methyl-2-oxocyclohexyl)oxy-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 163460881 |
| Molecular Formula | C13H20F2O6S |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-(3,5-diethyl-1-methyl-2-oxocyclohexyl)oxy-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | CCC1CC(CC)C(=O)C(C)(OC(=O)C(F)(F)S(=O)(=O)O)C1 |
| InChI | InChI=1S/C13H20F2O6S/c1-4-8-6-9(5-2)10(16)12(3,7-8)21-11(17)13(14,15)22(18,19)20/h8-9H,4-7H2,1-3H3,(H,18,19,20) |
| InChIKey | BOLHJNUIKGFMPU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|