C18H22F2O9S3 — CID 130375723
1,1-difluoro-2-[6-(methoxymethoxy)-4-oxospiro[6,6a-dihydro-3aH-[1,3]dithiolo[4,5-c]furan-2,4'-adamantane]-1'-yl]oxy-2-oxoethanesulfonic acid (PubChem CID 130375723) has the molecular formula C18H22F2O9S3 and a molecular weight of 516.56 g/mol. Its IUPAC name is 1,1-difluoro-2-[6-(methoxymethoxy)-4-oxospiro[6,6a-dihydro-3aH-[1,3]dithiolo[4,5-c]furan-2,4'-adamantane]-1'-yl]oxy-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[6-(methoxymethoxy)-4-oxospiro[6,6a-dihydro-3aH-[1,3]dithiolo[4,5-c]furan-2,4'-adamantane]-1'-yl]oxy-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 130375723 |
| Molecular Formula | C18H22F2O9S3 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | 1,1-difluoro-2-[6-(methoxymethoxy)-4-oxospiro[6,6a-dihydro-3aH-[1,3]dithiolo[4,5-c]furan-2,4'-adamantane]-1'-yl]oxy-2-oxoethanesulfonic acid |
| SMILES | COCOC1OC(=O)C2SC3(SC12)C1CC2CC3CC(OC(=O)C(F)(F)S(=O)(=O)O)(C2)C1 |
| InChI | InChI=1S/C18H22F2O9S3/c1-26-7-27-14-12-11(13(21)28-14)30-17(31-12)9-2-8-3-10(17)6-16(4-8,5-9)29-15(22)18(19,20)32(23,24)25/h8-12,14H,2-7H2,1H3,(H,23,24,25) |
| InChIKey | UPRMNVUJRWIYFR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|