C22H32N4O4S — CID 144522476
3,7-dimethyl-6-[[2-methyl-2-[(3-nitrophenyl)sulfanylamino]propanoyl]amino]bicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 144522476) has the molecular formula C22H32N4O4S and a molecular weight of 448.59 g/mol. Its IUPAC name is 3,7-dimethyl-6-[[2-methyl-2-[(3-nitrophenyl)sulfanylamino]propanoyl]amino]bicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | 3,7-dimethyl-6-[[2-methyl-2-[(3-nitrophenyl)sulfanylamino]propanoyl]amino]bicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 144522476 |
| Molecular Formula | C22H32N4O4S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 3,7-dimethyl-6-[[2-methyl-2-[(3-nitrophenyl)sulfanylamino]propanoyl]amino]bicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | CC1CC2CC(CC(C)(C(N)=O)C2)C1NC(=O)C(C)(C)NSc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H32N4O4S/c1-13-8-14-9-15(12-22(4,11-14)19(23)27)18(13)24-20(28)21(2,3)25-31-17-7-5-6-16(10-17)26(29)30/h5-7,10,13-15,18,25H,8-9,11-12H2,1-4H3,(H2,23,27)(H,24,28) |
| InChIKey | PKUSOESOUJKETN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|