C13H13F5N2O4S — CID 144552709
2-amino-4-methylsulfanyl-2-[3-nitro-5-(1,1,2,2,2-pentafluoroethyl)phenyl]butanoic acid (PubChem CID 144552709) has the molecular formula C13H13F5N2O4S and a molecular weight of 388.31 g/mol. Its IUPAC name is 2-amino-4-methylsulfanyl-2-[3-nitro-5-(1,1,2,2,2-pentafluoroethyl)phenyl]butanoic acid.
| Compound Name | 2-amino-4-methylsulfanyl-2-[3-nitro-5-(1,1,2,2,2-pentafluoroethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 144552709 |
| Molecular Formula | C13H13F5N2O4S |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 2-amino-4-methylsulfanyl-2-[3-nitro-5-(1,1,2,2,2-pentafluoroethyl)phenyl]butanoic acid |
| SMILES | CSCCC(N)(C(=O)O)c1cc([N+](=O)[O-])cc(C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F5N2O4S/c1-25-3-2-11(19,10(21)22)7-4-8(6-9(5-7)20(23)24)12(14,15)13(16,17)18/h4-6H,2-3,19H2,1H3,(H,21,22) |
| InChIKey | SCHMPFVHGSTGSZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|