C9H20N4O2 — CID 144561873
3-[amino(3-aminopropyl)amino]pyrrolidine-2,5-dione;ethane (PubChem CID 144561873) has the molecular formula C9H20N4O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-[amino(3-aminopropyl)amino]pyrrolidine-2,5-dione;ethane.
| Compound Name | 3-[amino(3-aminopropyl)amino]pyrrolidine-2,5-dione;ethane |
|---|---|
| PubChem CID | 144561873 |
| Molecular Formula | C9H20N4O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 3-[amino(3-aminopropyl)amino]pyrrolidine-2,5-dione;ethane |
| SMILES | CC.NCCCN(N)C1CC(=O)NC1=O |
| InChI | InChI=1S/C7H14N4O2.C2H6/c8-2-1-3-11(9)5-4-6(12)10-7(5)13;1-2/h5H,1-4,8-9H2,(H,10,12,13);1-2H3 |
| InChIKey | ZALSDZHAEGENCE-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|