C15H29N3O5S — CID 144569642
2-(carbamoylamino)ethyl prop-2-enoate;3-methylbutyl N-(3-sulfanylpropyl)carbamate (PubChem CID 144569642) has the molecular formula C15H29N3O5S and a molecular weight of 363.48 g/mol. Its IUPAC name is 2-(carbamoylamino)ethyl prop-2-enoate;3-methylbutyl N-(3-sulfanylpropyl)carbamate.
| Compound Name | 2-(carbamoylamino)ethyl prop-2-enoate;3-methylbutyl N-(3-sulfanylpropyl)carbamate |
|---|---|
| PubChem CID | 144569642 |
| Molecular Formula | C15H29N3O5S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-(carbamoylamino)ethyl prop-2-enoate;3-methylbutyl N-(3-sulfanylpropyl)carbamate |
| SMILES | C=CC(=O)OCCNC(N)=O.CC(C)CCOC(=O)NCCCS |
| InChI | InChI=1S/C9H19NO2S.C6H10N2O3/c1-8(2)4-6-12-9(11)10-5-3-7-13;1-2-5(9)11-4-3-8-6(7)10/h8,13H,3-7H2,1-2H3,(H,10,11);2H,1,3-4H2,(H3,7,8,10) |
| InChIKey | DXDQOJFCNFMRTE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|