About 7-propylidene-5,12-dihydroquinolino[2,3-b]acridin-14-one
7-propylidene-5,12-dihydroquinolino[2,3-b]acridin-14-one (PubChem CID 144583711) has the molecular formula C23H18N2O
and a molecular weight of 338.41 g/mol. Its IUPAC name is 7-propylidene-5,12-dihydroquinolino[2,3-b]acridin-14-one.
Molecular Properties
| Compound Name | 7-propylidene-5,12-dihydroquinolino[2,3-b]acridin-14-one |
| PubChem CID | 144583711 |
| Molecular Formula | C23H18N2O |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 7-propylidene-5,12-dihydroquinolino[2,3-b]acridin-14-one |
| SMILES | CCC=C1c2ccccc2Nc2cc3c(=O)c4ccccc4[nH]c3cc21 |
| InChI | InChI=1S/C23H18N2O/c1-2-7-14-15-8-3-5-10-19(15)24-21-13-18-22(12-17(14)21)25-20-11-6-4-9-16(20)23(18)26/h3-13,24H,2H2,1H3,(H,25,26) |
| InChIKey | FZOPWAIPGFYQOX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 7-propylidene-5,12-dihydroquinolino[2,3-b]acridin-14-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propylidene-5,12-dihydroquinolino[2,3-b]acridin-14-one?
The IUPAC name of 7-propylidene-5,12-dihydroquinolino[2,3-b]acridin-14-one (CID 144583711) is 7-propylidene-5,12-dihydroquinolino[2,3-b]acridin-14-one.
What is the SMILES notation for 7-propylidene-5,12-dihydroquinolino[2,3-b]acridin-14-one?
The canonical SMILES for 7-propylidene-5,12-dihydroquinolino[2,3-b]acridin-14-one is CCC=C1c2ccccc2Nc2cc3c(=O)c4ccccc4[nH]c3cc21.
What is the InChIKey of 7-propylidene-5,12-dihydroquinolino[2,3-b]acridin-14-one?
The InChIKey is FZOPWAIPGFYQOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N2O/c1-2-7-14-15-8-3-5-10-19(15)24-21-13-18-22(12-17(14)21)25-20-11-6-4-9-16(20)23(18)26/h3-13,24H,2H2,1H3,(H,25,26).
What are the key properties of 7-propylidene-5,12-dihydroquinolino[2,3-b]acridin-14-one?
7-propylidene-5,12-dihydroquinolino[2,3-b]acridin-14-one has a molecular weight of 338.41 g/mol, XLogP of 5.58, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propylidene-5,12-dihydroquinolino[2,3-b]acridin-14-one is sourced from PubChem (CID 144583711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).