C21H23ClF4N6O — CID 144592550
6-[4-(3-aminopropoxy)-2-fluoro-6-methylphenyl]-5-chloro-N-prop-2-enyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 144592550) has the molecular formula C21H23ClF4N6O and a molecular weight of 486.90 g/mol. Its IUPAC name is 6-[4-(3-aminopropoxy)-2-fluoro-6-methylphenyl]-5-chloro-N-prop-2-enyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 6-[4-(3-aminopropoxy)-2-fluoro-6-methylphenyl]-5-chloro-N-prop-2-enyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 144592550 |
| Molecular Formula | C21H23ClF4N6O |
| Molecular Weight | 486.90 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 6-[4-(3-aminopropoxy)-2-fluoro-6-methylphenyl]-5-chloro-N-prop-2-enyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C=CCN(c1c(-c2c(C)cc(OCCCN)cc2F)c(Cl)nc2ncnn12)[C@@H](C)C(F)(F)F |
| InChI | InChI=1S/C21H23ClF4N6O/c1-4-7-31(13(3)21(24,25)26)19-17(18(22)30-20-28-11-29-32(19)20)16-12(2)9-14(10-15(16)23)33-8-5-6-27/h4,9-11,13H,1,5-8,27H2,2-3H3/t13-/m0/s1 |
| InChIKey | VLOQXFSVPNHJMZ-ZDUSSCGKSA-N |
| XLogP | 4.56 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.90 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|