C13H15BO3S — CID 144598047
methanethiol;[(3Z,5Z)-2-methylidene-1-benzoxocin-3-yl]boronic acid (PubChem CID 144598047) has the molecular formula C13H15BO3S and a molecular weight of 262.14 g/mol. Its IUPAC name is methanethiol;[(3Z,5Z)-2-methylidene-1-benzoxocin-3-yl]boronic acid.
| Compound Name | methanethiol;[(3Z,5Z)-2-methylidene-1-benzoxocin-3-yl]boronic acid |
|---|---|
| PubChem CID | 144598047 |
| Molecular Formula | C13H15BO3S |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | methanethiol;[(3Z,5Z)-2-methylidene-1-benzoxocin-3-yl]boronic acid |
| SMILES | C=C1Oc2ccccc2/C=C\C=C/1B(O)O.CS |
| InChI | InChI=1S/C12H11BO3.CH4S/c1-9-11(13(14)15)7-4-6-10-5-2-3-8-12(10)16-9;1-2/h2-8,14-15H,1H2;2H,1H3/b6-4-,11-7+; |
| InChIKey | QJEFFTCLNOROIT-LAIAQJOMSA-N |
| XLogP | 2.09 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|