C8H16FN3O3 — CID 144600499
(3R)-N-(fluoromethyl)-3-hydroxy-N-methyl-2-(methylcarbamoylamino)butanamide (PubChem CID 144600499) has the molecular formula C8H16FN3O3 and a molecular weight of 221.23 g/mol. Its IUPAC name is (3R)-N-(fluoromethyl)-3-hydroxy-N-methyl-2-(methylcarbamoylamino)butanamide.
| Compound Name | (3R)-N-(fluoromethyl)-3-hydroxy-N-methyl-2-(methylcarbamoylamino)butanamide |
|---|---|
| PubChem CID | 144600499 |
| Molecular Formula | C8H16FN3O3 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (3R)-N-(fluoromethyl)-3-hydroxy-N-methyl-2-(methylcarbamoylamino)butanamide |
| SMILES | CNC(=O)NC(C(=O)N(C)CF)[C@@H](C)O |
| InChI | InChI=1S/C8H16FN3O3/c1-5(13)6(11-8(15)10-2)7(14)12(3)4-9/h5-6,13H,4H2,1-3H3,(H2,10,11,15)/t5-,6?/m1/s1 |
| InChIKey | CBAHJPWVYMIGBH-LWOQYNTDSA-N |
| XLogP | -0.95 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|