C22H44N4O4 — CID 144600513
ethane;1-(2-hydroxy-4-oxopentan-3-yl)-3-methylurea;3-methyl-5-[methyl-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]amino]pentan-2-ol (PubChem CID 144600513) has the molecular formula C22H44N4O4 and a molecular weight of 428.62 g/mol. Its IUPAC name is ethane;1-(2-hydroxy-4-oxopentan-3-yl)-3-methylurea;3-methyl-5-[methyl-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]amino]pentan-2-ol.
| Compound Name | ethane;1-(2-hydroxy-4-oxopentan-3-yl)-3-methylurea;3-methyl-5-[methyl-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]amino]pentan-2-ol |
|---|---|
| PubChem CID | 144600513 |
| Molecular Formula | C22H44N4O4 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.34 |
| IUPAC Name | ethane;1-(2-hydroxy-4-oxopentan-3-yl)-3-methylurea;3-methyl-5-[methyl-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]amino]pentan-2-ol |
| SMILES | C=C/C=C(/CN(C)CCC(C)C(C)O)N=C.CC.CNC(=O)NC(C(C)=O)C(C)O |
| InChI | InChI=1S/C13H24N2O.C7H14N2O3.C2H6/c1-6-7-13(14-4)10-15(5)9-8-11(2)12(3)16;1-4(10)6(5(2)11)9-7(12)8-3;1-2/h6-7,11-12,16H,1,4,8-10H2,2-3,5H3;4,6,10H,1-3H3,(H2,8,9,12);1-2H3/b13-7-;; |
| InChIKey | HJKKBSSOBDSZKV-ZFPLEQNJSA-N |
| XLogP | 2.38 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|