C7H5ClN2OS — CID 144620136
N-(7-chlorothieno[3,2-b]pyridin-6-yl)hydroxylamine (PubChem CID 144620136) has the molecular formula C7H5ClN2OS and a molecular weight of 200.65 g/mol. Its IUPAC name is N-(7-chlorothieno[3,2-b]pyridin-6-yl)hydroxylamine.
| Compound Name | N-(7-chlorothieno[3,2-b]pyridin-6-yl)hydroxylamine |
|---|---|
| PubChem CID | 144620136 |
| Molecular Formula | C7H5ClN2OS |
| Molecular Weight | 200.65 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | N-(7-chlorothieno[3,2-b]pyridin-6-yl)hydroxylamine |
| SMILES | ONc1cnc2ccsc2c1Cl |
| InChI | InChI=1S/C7H5ClN2OS/c8-6-5(10-11)3-9-4-1-2-12-7(4)6/h1-3,10-11H |
| InChIKey | RWUBBRSRZBHQFA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.65 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|