C24H35N3O4S — CID 144630037
4-amino-1-[4-hydroxy-5-(sulfanyloxymethyl)oxolan-2-yl]-5-[2-(2,4,5-trimethylphenyl)ethynyl]pyrimidin-2-one;ethane (PubChem CID 144630037) has the molecular formula C24H35N3O4S and a molecular weight of 461.63 g/mol. Its IUPAC name is 4-amino-1-[4-hydroxy-5-(sulfanyloxymethyl)oxolan-2-yl]-5-[2-(2,4,5-trimethylphenyl)ethynyl]pyrimidin-2-one;ethane.
| Compound Name | 4-amino-1-[4-hydroxy-5-(sulfanyloxymethyl)oxolan-2-yl]-5-[2-(2,4,5-trimethylphenyl)ethynyl]pyrimidin-2-one;ethane |
|---|---|
| PubChem CID | 144630037 |
| Molecular Formula | C24H35N3O4S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 4-amino-1-[4-hydroxy-5-(sulfanyloxymethyl)oxolan-2-yl]-5-[2-(2,4,5-trimethylphenyl)ethynyl]pyrimidin-2-one;ethane |
| SMILES | CC.CC.Cc1cc(C)c(C#Cc2cn(C3CC(O)C(COS)O3)c(=O)nc2N)cc1C |
| InChI | InChI=1S/C20H23N3O4S.2C2H6/c1-11-6-13(3)14(7-12(11)2)4-5-15-9-23(20(25)22-19(15)21)18-8-16(24)17(27-18)10-26-28;2*1-2/h6-7,9,16-18,24,28H,8,10H2,1-3H3,(H2,21,22,25);2*1-2H3 |
| InChIKey | JEOGXLLVCRWCPL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|