C19H22F2O — CID 144630979
1-[(3Z,7Z)-9-ethoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]cyclopentene (PubChem CID 144630979) has the molecular formula C19H22F2O and a molecular weight of 304.38 g/mol. Its IUPAC name is 1-[(3Z,7Z)-9-ethoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]cyclopentene.
| Compound Name | 1-[(3Z,7Z)-9-ethoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]cyclopentene |
|---|---|
| PubChem CID | 144630979 |
| Molecular Formula | C19H22F2O |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 1-[(3Z,7Z)-9-ethoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]cyclopentene |
| SMILES | C=C(/C=C\C(=C)C1=CCCC1)C(=C)/C(F)=C(/F)C(=C)OCC |
| InChI | InChI=1S/C19H22F2O/c1-6-22-16(5)19(21)18(20)15(4)13(2)11-12-14(3)17-9-7-8-10-17/h9,11-12H,2-8,10H2,1H3/b12-11-,19-18- |
| InChIKey | FPUASQRXYKFPFZ-GMRTXPORSA-N |
| XLogP | 6.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|