C12H22N2 — CID 144686628
(Z)-N,3,5-trimethyl-4-methylidene-6-(methylideneamino)hept-5-en-1-amine (PubChem CID 144686628) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is (Z)-N,3,5-trimethyl-4-methylidene-6-(methylideneamino)hept-5-en-1-amine.
| Compound Name | (Z)-N,3,5-trimethyl-4-methylidene-6-(methylideneamino)hept-5-en-1-amine |
|---|---|
| PubChem CID | 144686628 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (Z)-N,3,5-trimethyl-4-methylidene-6-(methylideneamino)hept-5-en-1-amine |
| SMILES | C=N/C(C)=C(/C)C(=C)C(C)CCNC |
| InChI | InChI=1S/C12H22N2/c1-9(7-8-13-5)10(2)11(3)12(4)14-6/h9,13H,2,6-8H2,1,3-5H3/b12-11- |
| InChIKey | UJCMNDGTYDTIOB-QXMHVHEDSA-N |
| XLogP | 2.78 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|