C10H11N — CID 144687352
2,3-bis(ethenyl)-4,5-dimethylidene-1H-pyrrole (PubChem CID 144687352) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-4,5-dimethylidene-1H-pyrrole.
| Compound Name | 2,3-bis(ethenyl)-4,5-dimethylidene-1H-pyrrole |
|---|---|
| PubChem CID | 144687352 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 2,3-bis(ethenyl)-4,5-dimethylidene-1H-pyrrole |
| SMILES | C=Cc1[nH]c(=C)c(=C)c1C=C |
| InChI | InChI=1S/C10H11N/c1-5-9-7(3)8(4)11-10(9)6-2/h5-6,11H,1-4H2 |
| InChIKey | CQKOBZDAZUDWAV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |