About 2,3-bis(ethenyl)-4,5-dimethylidene-1H-pyrrole
2,3-bis(ethenyl)-4,5-dimethylidene-1H-pyrrole (PubChem CID 144687352) has the molecular formula C10H11N
and a molecular weight of 145.20 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-4,5-dimethylidene-1H-pyrrole.
Molecular Properties
| Compound Name | 2,3-bis(ethenyl)-4,5-dimethylidene-1H-pyrrole |
| PubChem CID | 144687352 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 2,3-bis(ethenyl)-4,5-dimethylidene-1H-pyrrole |
| SMILES | C=Cc1[nH]c(=C)c(=C)c1C=C |
| InChI | InChI=1S/C10H11N/c1-5-9-7(3)8(4)11-10(9)6-2/h5-6,11H,1-4H2 |
| InChIKey | CQKOBZDAZUDWAV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-bis(ethenyl)-4,5-dimethylidene-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(ethenyl)-4,5-dimethylidene-1H-pyrrole?
The IUPAC name of 2,3-bis(ethenyl)-4,5-dimethylidene-1H-pyrrole (CID 144687352) is 2,3-bis(ethenyl)-4,5-dimethylidene-1H-pyrrole.
What is the SMILES notation for 2,3-bis(ethenyl)-4,5-dimethylidene-1H-pyrrole?
The canonical SMILES for 2,3-bis(ethenyl)-4,5-dimethylidene-1H-pyrrole is C=Cc1[nH]c(=C)c(=C)c1C=C.
What is the InChIKey of 2,3-bis(ethenyl)-4,5-dimethylidene-1H-pyrrole?
The InChIKey is CQKOBZDAZUDWAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N/c1-5-9-7(3)8(4)11-10(9)6-2/h5-6,11H,1-4H2.
What are the key properties of 2,3-bis(ethenyl)-4,5-dimethylidene-1H-pyrrole?
2,3-bis(ethenyl)-4,5-dimethylidene-1H-pyrrole has a molecular weight of 145.20 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(ethenyl)-4,5-dimethylidene-1H-pyrrole is sourced from PubChem (CID 144687352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).