C17H22BN3O4 — CID 144718745
2-nitroso-3-(3-piperidin-1-ylprop-1-en-2-ylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 144718745) has the molecular formula C17H22BN3O4 and a molecular weight of 343.19 g/mol. Its IUPAC name is 2-nitroso-3-(3-piperidin-1-ylprop-1-en-2-ylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | 2-nitroso-3-(3-piperidin-1-ylprop-1-en-2-ylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 144718745 |
| Molecular Formula | C17H22BN3O4 |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2-nitroso-3-(3-piperidin-1-ylprop-1-en-2-ylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | C=C(CN1CCCCC1)NC1Cc2cccc(C(=O)O)c2OB1N=O |
| InChI | InChI=1S/C17H22BN3O4/c1-12(11-21-8-3-2-4-9-21)19-15-10-13-6-5-7-14(17(22)23)16(13)25-18(15)20-24/h5-7,15,19H,1-4,8-11H2,(H,22,23) |
| InChIKey | INMCKIHCWNLLKG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|