C40H50BNO2 — CID 144741396
ethane;N-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1-[6-methyl-5-[(Z)-prop-1-enyl]naphthalen-2-yl]ethanimine (PubChem CID 144741396) has the molecular formula C40H50BNO2 and a molecular weight of 587.66 g/mol. Its IUPAC name is ethane;N-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1-[6-methyl-5-[(Z)-prop-1-enyl]naphthalen-2-yl]ethanimine.
| Compound Name | ethane;N-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1-[6-methyl-5-[(Z)-prop-1-enyl]naphthalen-2-yl]ethanimine |
|---|---|
| PubChem CID | 144741396 |
| Molecular Formula | C40H50BNO2 |
| Molecular Weight | 587.66 g/mol |
| Exact Mass | 587.39 |
| IUPAC Name | ethane;N-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1-[6-methyl-5-[(Z)-prop-1-enyl]naphthalen-2-yl]ethanimine |
| SMILES | C=c1cccc/c1=C(/N=C(\C)c1ccc2c(/C=C\C)c(C)ccc2c1)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1.CC.CC |
| InChI | InChI=1S/C36H38BNO2.2C2H6/c1-9-12-31-25(3)15-16-29-23-28(19-22-33(29)31)26(4)38-34(32-14-11-10-13-24(32)2)27-17-20-30(21-18-27)37-39-35(5,6)36(7,8)40-37;2*1-2/h9-23H,2H2,1,3-8H3;2*1-2H3/b12-9-,34-32-,38-26+;; |
| InChIKey | NRDPZXAPHVYXHU-AEJBXUGOSA-N |
| XLogP | 8.61 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.66 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|