C29H37BN2O2 — CID 144741383
ethane;(3E)-3-ethenyl-N-[(E)-(3-methylidene-2-pyridinylidene)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]hexa-3,5-dien-2-imine (PubChem CID 144741383) has the molecular formula C29H37BN2O2 and a molecular weight of 456.44 g/mol. Its IUPAC name is ethane;(3E)-3-ethenyl-N-[(E)-(3-methylidene-2-pyridinylidene)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]hexa-3,5-dien-2-imine.
| Compound Name | ethane;(3E)-3-ethenyl-N-[(E)-(3-methylidene-2-pyridinylidene)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]hexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 144741383 |
| Molecular Formula | C29H37BN2O2 |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | ethane;(3E)-3-ethenyl-N-[(E)-(3-methylidene-2-pyridinylidene)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]hexa-3,5-dien-2-imine |
| SMILES | C=C/C=C(C=C)/C(C)=N/C(c1ccc(B2OC(C)(C)C(C)(C)O2)cc1)=c1/ncccc1=C.CC |
| InChI | InChI=1S/C27H31BN2O2.C2H6/c1-9-12-21(10-2)20(4)30-25(24-19(3)13-11-18-29-24)22-14-16-23(17-15-22)28-31-26(5,6)27(7,8)32-28;1-2/h9-18H,1-3H2,4-8H3;1-2H3/b21-12+,25-24+,30-20+; |
| InChIKey | CBXLXCKOJCWHHT-JAPDRJHYSA-N |
| XLogP | 4.73 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|