C28H34N8O2 — CID 144752068
N-[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]formamide;1-[4-(N,N'-dimethylcarbamimidoyl)phenyl]-3-[4-methyl-3-(methylamino)phenyl]urea (PubChem CID 144752068) has the molecular formula C28H34N8O2 and a molecular weight of 514.63 g/mol. Its IUPAC name is N-[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]formamide;1-[4-(N,N'-dimethylcarbamimidoyl)phenyl]-3-[4-methyl-3-(methylamino)phenyl]urea.
| Compound Name | N-[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]formamide;1-[4-(N,N'-dimethylcarbamimidoyl)phenyl]-3-[4-methyl-3-(methylamino)phenyl]urea |
|---|---|
| PubChem CID | 144752068 |
| Molecular Formula | C28H34N8O2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | N-[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]formamide;1-[4-(N,N'-dimethylcarbamimidoyl)phenyl]-3-[4-methyl-3-(methylamino)phenyl]urea |
| SMILES | C/N=C(\NC)c1ccc(NC(=O)Nc2ccc(C)c(NC)c2)cc1.O=CNc1cccc(C2=NCCN2)c1 |
| InChI | InChI=1S/C18H23N5O.C10H11N3O/c1-12-5-8-15(11-16(12)19-2)23-18(24)22-14-9-6-13(7-10-14)17(20-3)21-4;14-7-13-9-3-1-2-8(6-9)10-11-4-5-12-10/h5-11,19H,1-4H3,(H,20,21)(H2,22,23,24);1-3,6-7H,4-5H2,(H,11,12)(H,13,14) |
| InChIKey | FEDRFZBNVIILQV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 131.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|