C38H43N9O4 — CID 144755053
2-butan-2-yl-4-[4-[4-[4-[[2-quinolin-5-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-3H-1,2,4-triazol-3-ol (PubChem CID 144755053) has the molecular formula C38H43N9O4 and a molecular weight of 689.82 g/mol. Its IUPAC name is 2-butan-2-yl-4-[4-[4-[4-[[2-quinolin-5-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-3H-1,2,4-triazol-3-ol.
| Compound Name | 2-butan-2-yl-4-[4-[4-[4-[[2-quinolin-5-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-3H-1,2,4-triazol-3-ol |
|---|---|
| PubChem CID | 144755053 |
| Molecular Formula | C38H43N9O4 |
| Molecular Weight | 689.82 g/mol |
| Exact Mass | 689.34 |
| IUPAC Name | 2-butan-2-yl-4-[4-[4-[4-[[2-quinolin-5-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-3H-1,2,4-triazol-3-ol |
| SMILES | CCC(C)N1N=CN(c2ccc(N3CCN(c4ccc(OCC5COC(Cn6nccn6)(c6cccc7ncccc67)O5)cc4)CC3)cc2)C1O |
| InChI | InChI=1S/C38H43N9O4/c1-3-28(2)47-37(48)45(27-42-47)31-11-9-29(10-12-31)43-20-22-44(23-21-43)30-13-15-32(16-14-30)49-24-33-25-50-38(51-33,26-46-40-18-19-41-46)35-7-4-8-36-34(35)6-5-17-39-36/h4-19,27-28,33,37,48H,3,20-26H2,1-2H3 |
| InChIKey | AKOFASVJTGYVFE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.82 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|