C34H42N9O4+ — CID 147320672
[N-(butan-2-ylcarbamoyl)-4-[4-[4-[[2-pyridin-4-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]anilino]methylideneazanium (PubChem CID 147320672) has the molecular formula C34H42N9O4+ and a molecular weight of 640.77 g/mol. Its IUPAC name is [N-(butan-2-ylcarbamoyl)-4-[4-[4-[[2-pyridin-4-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]anilino]methylideneazanium.
| Compound Name | [N-(butan-2-ylcarbamoyl)-4-[4-[4-[[2-pyridin-4-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]anilino]methylideneazanium |
|---|---|
| PubChem CID | 147320672 |
| Molecular Formula | C34H42N9O4+ |
| Molecular Weight | 640.77 g/mol |
| Exact Mass | 640.34 |
| IUPAC Name | [N-(butan-2-ylcarbamoyl)-4-[4-[4-[[2-pyridin-4-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]anilino]methylideneazanium |
| SMILES | CCC(C)NC(=O)N(C=[NH2+])c1ccc(N2CCN(c3ccc(OCC4COC(Cn5nccn5)(c5ccncc5)O4)cc3)CC2)cc1 |
| InChI | InChI=1S/C34H41N9O4/c1-3-26(2)39-33(44)42(25-35)30-6-4-28(5-7-30)40-18-20-41(21-19-40)29-8-10-31(11-9-29)45-22-32-23-46-34(47-32,24-43-37-16-17-38-43)27-12-14-36-15-13-27/h4-17,25-26,32,35H,3,18-24H2,1-2H3,(H,39,44)/p+1 |
| InChIKey | CZSSHRCSECSQQI-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 135.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.77 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|