C39H53N3O4S — CID 144758643
4-tert-butylbenzaldehyde;ethane;methyl 3-[4-[5-(4-heptoxyphenyl)-1,3,4-thiadiazol-2-yl]phenyl]-2-(methylamino)propanoate (PubChem CID 144758643) has the molecular formula C39H53N3O4S and a molecular weight of 659.94 g/mol. Its IUPAC name is 4-tert-butylbenzaldehyde;ethane;methyl 3-[4-[5-(4-heptoxyphenyl)-1,3,4-thiadiazol-2-yl]phenyl]-2-(methylamino)propanoate.
| Compound Name | 4-tert-butylbenzaldehyde;ethane;methyl 3-[4-[5-(4-heptoxyphenyl)-1,3,4-thiadiazol-2-yl]phenyl]-2-(methylamino)propanoate |
|---|---|
| PubChem CID | 144758643 |
| Molecular Formula | C39H53N3O4S |
| Molecular Weight | 659.94 g/mol |
| Exact Mass | 659.38 |
| IUPAC Name | 4-tert-butylbenzaldehyde;ethane;methyl 3-[4-[5-(4-heptoxyphenyl)-1,3,4-thiadiazol-2-yl]phenyl]-2-(methylamino)propanoate |
| SMILES | CC.CC(C)(C)c1ccc(C=O)cc1.CCCCCCCOc1ccc(-c2nnc(-c3ccc(CC(NC)C(=O)OC)cc3)s2)cc1 |
| InChI | InChI=1S/C26H33N3O3S.C11H14O.C2H6/c1-4-5-6-7-8-17-32-22-15-13-21(14-16-22)25-29-28-24(33-25)20-11-9-19(10-12-20)18-23(27-2)26(30)31-3;1-11(2,3)10-6-4-9(8-12)5-7-10;1-2/h9-16,23,27H,4-8,17-18H2,1-3H3;4-8H,1-3H3;1-2H3 |
| InChIKey | CIIWOHNAQMXNSZ-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.94 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|