C38H48N4O5S — CID 134203137
(2R)-2-[[(2S)-2-[[(4-tert-butylphenyl)-hydroxymethyl]amino]-3-[4-[5-(4-heptoxyphenyl)-1,3,4-thiadiazol-2-yl]phenyl]propanoyl]amino]propanoic acid (PubChem CID 134203137) has the molecular formula C38H48N4O5S and a molecular weight of 672.89 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-[[(4-tert-butylphenyl)-hydroxymethyl]amino]-3-[4-[5-(4-heptoxyphenyl)-1,3,4-thiadiazol-2-yl]phenyl]propanoyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-[[(4-tert-butylphenyl)-hydroxymethyl]amino]-3-[4-[5-(4-heptoxyphenyl)-1,3,4-thiadiazol-2-yl]phenyl]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 134203137 |
| Molecular Formula | C38H48N4O5S |
| Molecular Weight | 672.89 g/mol |
| Exact Mass | 672.33 |
| IUPAC Name | (2R)-2-[[(2S)-2-[[(4-tert-butylphenyl)-hydroxymethyl]amino]-3-[4-[5-(4-heptoxyphenyl)-1,3,4-thiadiazol-2-yl]phenyl]propanoyl]amino]propanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2nnc(-c3ccc(C[C@H](NC(O)c4ccc(C(C)(C)C)cc4)C(=O)N[C@H](C)C(=O)O)cc3)s2)cc1 |
| InChI | InChI=1S/C38H48N4O5S/c1-6-7-8-9-10-23-47-31-21-17-29(18-22-31)36-42-41-35(48-36)28-13-11-26(12-14-28)24-32(34(44)39-25(2)37(45)46)40-33(43)27-15-19-30(20-16-27)38(3,4)5/h11-22,25,32-33,40,43H,6-10,23-24H2,1-5H3,(H,39,44)(H,45,46)/t25-,32+,33?/m1/s1 |
| InChIKey | BWAWUNFYRRJPLT-PMZDHDIQSA-N |
| XLogP | 7.30 |
| TPSA | 133.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.89 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|